About 2-chlorobicyclo[2.2.1]hepta-1,3,5-triene;cyclohexanone
2-chlorobicyclo[2.2.1]hepta-1,3,5-triene;cyclohexanone (PubChem CID 20978065) has the molecular formula C13H15ClO
and a molecular weight of 222.72 g/mol. Its IUPAC name is 2-chlorobicyclo[2.2.1]hepta-1,3,5-triene;cyclohexanone.
Molecular Properties
| Compound Name | 2-chlorobicyclo[2.2.1]hepta-1,3,5-triene;cyclohexanone |
| PubChem CID | 20978065 |
| Molecular Formula | C13H15ClO |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-chlorobicyclo[2.2.1]hepta-1,3,5-triene;cyclohexanone |
| SMILES | ClC1=C2C=CC(=C1)C2.O=C1CCCCC1 |
| InChI | InChI=1S/C7H5Cl.C6H10O/c8-7-4-5-1-2-6(7)3-5;7-6-4-2-1-3-5-6/h1-2,4H,3H2;1-5H2 |
| InChIKey | YRXWTPZUDAEFNG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chlorobicyclo[2.2.1]hepta-1,3,5-triene;cyclohexanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobicyclo[2.2.1]hepta-1,3,5-triene;cyclohexanone?
The IUPAC name of 2-chlorobicyclo[2.2.1]hepta-1,3,5-triene;cyclohexanone (CID 20978065) is 2-chlorobicyclo[2.2.1]hepta-1,3,5-triene;cyclohexanone.
What is the SMILES notation for 2-chlorobicyclo[2.2.1]hepta-1,3,5-triene;cyclohexanone?
The canonical SMILES for 2-chlorobicyclo[2.2.1]hepta-1,3,5-triene;cyclohexanone is ClC1=C2C=CC(=C1)C2.O=C1CCCCC1.
What is the InChIKey of 2-chlorobicyclo[2.2.1]hepta-1,3,5-triene;cyclohexanone?
The InChIKey is YRXWTPZUDAEFNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl.C6H10O/c8-7-4-5-1-2-6(7)3-5;7-6-4-2-1-3-5-6/h1-2,4H,3H2;1-5H2.
What are the key properties of 2-chlorobicyclo[2.2.1]hepta-1,3,5-triene;cyclohexanone?
2-chlorobicyclo[2.2.1]hepta-1,3,5-triene;cyclohexanone has a molecular weight of 222.72 g/mol, XLogP of 3.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobicyclo[2.2.1]hepta-1,3,5-triene;cyclohexanone is sourced from PubChem (CID 20978065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).