About N-hydroxy-2-piperidin-1-ylpropanamide;methane;hydrochloride
N-hydroxy-2-piperidin-1-ylpropanamide;methane;hydrochloride (PubChem CID 20978232) has the molecular formula C9H21ClN2O2
and a molecular weight of 224.73 g/mol. Its IUPAC name is N-hydroxy-2-piperidin-1-ylpropanamide;methane;hydrochloride.
Molecular Properties
| Compound Name | N-hydroxy-2-piperidin-1-ylpropanamide;methane;hydrochloride |
| PubChem CID | 20978232 |
| Molecular Formula | C9H21ClN2O2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-hydroxy-2-piperidin-1-ylpropanamide;methane;hydrochloride |
| SMILES | C.CC(C(=O)NO)N1CCCCC1.Cl |
| InChI | InChI=1S/C8H16N2O2.CH4.ClH/c1-7(8(11)9-12)10-5-3-2-4-6-10;;/h7,12H,2-6H2,1H3,(H,9,11);1H4;1H |
| InChIKey | BDQBHWPCYMMZMR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-2-piperidin-1-ylpropanamide;methane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-2-piperidin-1-ylpropanamide;methane;hydrochloride?
The IUPAC name of N-hydroxy-2-piperidin-1-ylpropanamide;methane;hydrochloride (CID 20978232) is N-hydroxy-2-piperidin-1-ylpropanamide;methane;hydrochloride.
What is the SMILES notation for N-hydroxy-2-piperidin-1-ylpropanamide;methane;hydrochloride?
The canonical SMILES for N-hydroxy-2-piperidin-1-ylpropanamide;methane;hydrochloride is C.CC(C(=O)NO)N1CCCCC1.Cl.
What is the InChIKey of N-hydroxy-2-piperidin-1-ylpropanamide;methane;hydrochloride?
The InChIKey is BDQBHWPCYMMZMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2.CH4.ClH/c1-7(8(11)9-12)10-5-3-2-4-6-10;;/h7,12H,2-6H2,1H3,(H,9,11);1H4;1H.
What are the key properties of N-hydroxy-2-piperidin-1-ylpropanamide;methane;hydrochloride?
N-hydroxy-2-piperidin-1-ylpropanamide;methane;hydrochloride has a molecular weight of 224.73 g/mol, XLogP of 1.42, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-2-piperidin-1-ylpropanamide;methane;hydrochloride is sourced from PubChem (CID 20978232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).