C21H27NO5 — CID 20978727
dipropan-2-yl 3-formyl-2,3,4,4a,9,9a-hexahydrocarbazole-1,1-dicarboxylate (PubChem CID 20978727) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is dipropan-2-yl 3-formyl-2,3,4,4a,9,9a-hexahydrocarbazole-1,1-dicarboxylate.
| Compound Name | dipropan-2-yl 3-formyl-2,3,4,4a,9,9a-hexahydrocarbazole-1,1-dicarboxylate |
|---|---|
| PubChem CID | 20978727 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | dipropan-2-yl 3-formyl-2,3,4,4a,9,9a-hexahydrocarbazole-1,1-dicarboxylate |
| SMILES | CC(C)OC(=O)C1(C(=O)OC(C)C)CC(C=O)CC2c3ccccc3NC21 |
| InChI | InChI=1S/C21H27NO5/c1-12(2)26-19(24)21(20(25)27-13(3)4)10-14(11-23)9-16-15-7-5-6-8-17(15)22-18(16)21/h5-8,11-14,16,18,22H,9-10H2,1-4H3 |
| InChIKey | GDLXOZHVKNICFV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|