About [4,5-diamino-3,6-bis(phenylmethoxy)oxan-2-yl]methanol
[4,5-diamino-3,6-bis(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 20979039) has the molecular formula C20H26N2O4
and a molecular weight of 358.44 g/mol. Its IUPAC name is [4,5-diamino-3,6-bis(phenylmethoxy)oxan-2-yl]methanol.
Molecular Properties
| Compound Name | [4,5-diamino-3,6-bis(phenylmethoxy)oxan-2-yl]methanol |
| PubChem CID | 20979039 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | [4,5-diamino-3,6-bis(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | NC1C(OCc2ccccc2)OC(CO)C(OCc2ccccc2)C1N |
| InChI | InChI=1S/C20H26N2O4/c21-17-18(22)20(25-13-15-9-5-2-6-10-15)26-16(11-23)19(17)24-12-14-7-3-1-4-8-14/h1-10,16-20,23H,11-13,21-22H2 |
| InChIKey | QKCKKXXNIQEYDZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4,5-diamino-3,6-bis(phenylmethoxy)oxan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-diamino-3,6-bis(phenylmethoxy)oxan-2-yl]methanol?
The IUPAC name of [4,5-diamino-3,6-bis(phenylmethoxy)oxan-2-yl]methanol (CID 20979039) is [4,5-diamino-3,6-bis(phenylmethoxy)oxan-2-yl]methanol.
What is the SMILES notation for [4,5-diamino-3,6-bis(phenylmethoxy)oxan-2-yl]methanol?
The canonical SMILES for [4,5-diamino-3,6-bis(phenylmethoxy)oxan-2-yl]methanol is NC1C(OCc2ccccc2)OC(CO)C(OCc2ccccc2)C1N.
What is the InChIKey of [4,5-diamino-3,6-bis(phenylmethoxy)oxan-2-yl]methanol?
The InChIKey is QKCKKXXNIQEYDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O4/c21-17-18(22)20(25-13-15-9-5-2-6-10-15)26-16(11-23)19(17)24-12-14-7-3-1-4-8-14/h1-10,16-20,23H,11-13,21-22H2.
What are the key properties of [4,5-diamino-3,6-bis(phenylmethoxy)oxan-2-yl]methanol?
[4,5-diamino-3,6-bis(phenylmethoxy)oxan-2-yl]methanol has a molecular weight of 358.44 g/mol, XLogP of 1.16, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-diamino-3,6-bis(phenylmethoxy)oxan-2-yl]methanol is sourced from PubChem (CID 20979039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).