About [5-amino-4-azido-3,6-bis(phenylmethoxy)oxan-2-yl]methanol
[5-amino-4-azido-3,6-bis(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 20979040) has the molecular formula C20H24N4O4
and a molecular weight of 384.44 g/mol. Its IUPAC name is [5-amino-4-azido-3,6-bis(phenylmethoxy)oxan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-amino-4-azido-3,6-bis(phenylmethoxy)oxan-2-yl]methanol |
| PubChem CID | 20979040 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | [5-amino-4-azido-3,6-bis(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | [N-]=[N+]=NC1C(N)C(OCc2ccccc2)OC(CO)C1OCc1ccccc1 |
| InChI | InChI=1S/C20H24N4O4/c21-17-18(23-24-22)19(26-12-14-7-3-1-4-8-14)16(11-25)28-20(17)27-13-15-9-5-2-6-10-15/h1-10,16-20,25H,11-13,21H2 |
| InChIKey | RTWCSZRCSZJIRN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 122.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [5-amino-4-azido-3,6-bis(phenylmethoxy)oxan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-amino-4-azido-3,6-bis(phenylmethoxy)oxan-2-yl]methanol?
The IUPAC name of [5-amino-4-azido-3,6-bis(phenylmethoxy)oxan-2-yl]methanol (CID 20979040) is [5-amino-4-azido-3,6-bis(phenylmethoxy)oxan-2-yl]methanol.
What is the SMILES notation for [5-amino-4-azido-3,6-bis(phenylmethoxy)oxan-2-yl]methanol?
The canonical SMILES for [5-amino-4-azido-3,6-bis(phenylmethoxy)oxan-2-yl]methanol is [N-]=[N+]=NC1C(N)C(OCc2ccccc2)OC(CO)C1OCc1ccccc1.
What is the InChIKey of [5-amino-4-azido-3,6-bis(phenylmethoxy)oxan-2-yl]methanol?
The InChIKey is RTWCSZRCSZJIRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O4/c21-17-18(23-24-22)19(26-12-14-7-3-1-4-8-14)16(11-25)28-20(17)27-13-15-9-5-2-6-10-15/h1-10,16-20,25H,11-13,21H2.
What are the key properties of [5-amino-4-azido-3,6-bis(phenylmethoxy)oxan-2-yl]methanol?
[5-amino-4-azido-3,6-bis(phenylmethoxy)oxan-2-yl]methanol has a molecular weight of 384.44 g/mol, XLogP of 2.51, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-amino-4-azido-3,6-bis(phenylmethoxy)oxan-2-yl]methanol is sourced from PubChem (CID 20979040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).