About 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-4-methoxy-3H-furan-2-one
5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-4-methoxy-3H-furan-2-one (PubChem CID 20979787) has the molecular formula C10H14O6
and a molecular weight of 230.22 g/mol. Its IUPAC name is 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-4-methoxy-3H-furan-2-one.
Molecular Properties
| Compound Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-4-methoxy-3H-furan-2-one |
| PubChem CID | 20979787 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-4-methoxy-3H-furan-2-one |
| SMILES | COC1=C(C2COC(C)(C)O2)OC(=O)C1O |
| InChI | InChI=1S/C10H14O6/c1-10(2)14-4-5(16-10)7-8(13-3)6(11)9(12)15-7/h5-6,11H,4H2,1-3H3 |
| InChIKey | QXNCIAWXPLUGBK-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-4-methoxy-3H-furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-4-methoxy-3H-furan-2-one?
The IUPAC name of 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-4-methoxy-3H-furan-2-one (CID 20979787) is 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-4-methoxy-3H-furan-2-one.
What is the SMILES notation for 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-4-methoxy-3H-furan-2-one?
The canonical SMILES for 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-4-methoxy-3H-furan-2-one is COC1=C(C2COC(C)(C)O2)OC(=O)C1O.
What is the InChIKey of 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-4-methoxy-3H-furan-2-one?
The InChIKey is QXNCIAWXPLUGBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O6/c1-10(2)14-4-5(16-10)7-8(13-3)6(11)9(12)15-7/h5-6,11H,4H2,1-3H3.
What are the key properties of 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-4-methoxy-3H-furan-2-one?
5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-4-methoxy-3H-furan-2-one has a molecular weight of 230.22 g/mol, XLogP of -0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-4-methoxy-3H-furan-2-one is sourced from PubChem (CID 20979787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).