C13H14N4S — CID 20980032
1,2-dipyridin-3-ylethylthiourea (PubChem CID 20980032) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is 1,2-dipyridin-3-ylethylthiourea.
| Compound Name | 1,2-dipyridin-3-ylethylthiourea |
|---|---|
| PubChem CID | 20980032 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1,2-dipyridin-3-ylethylthiourea |
| SMILES | NC(=S)NC(Cc1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C13H14N4S/c14-13(18)17-12(11-4-2-6-16-9-11)7-10-3-1-5-15-8-10/h1-6,8-9,12H,7H2,(H3,14,17,18) |
| InChIKey | IGYYJVMTUQMHLB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|