About 3-propoxybuta-1,3-dienylazanium
3-propoxybuta-1,3-dienylazanium (PubChem CID 20980264) has the molecular formula C7H14NO+
and a molecular weight of 128.19 g/mol. Its IUPAC name is 3-propoxybuta-1,3-dienylazanium.
Molecular Properties
| Compound Name | 3-propoxybuta-1,3-dienylazanium |
| PubChem CID | 20980264 |
| Molecular Formula | C7H14NO+ |
| Molecular Weight | 128.19 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | 3-propoxybuta-1,3-dienylazanium |
| SMILES | C=C(C=C[NH3+])OCCC |
| InChI | InChI=1S/C7H13NO/c1-3-6-9-7(2)4-5-8/h4-5H,2-3,6,8H2,1H3/p+1 |
| InChIKey | HCGAABSDBDGHBV-UHFFFAOYSA-O |
| XLogP | 0.68 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-propoxybuta-1,3-dienylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propoxybuta-1,3-dienylazanium?
The IUPAC name of 3-propoxybuta-1,3-dienylazanium (CID 20980264) is 3-propoxybuta-1,3-dienylazanium.
What is the SMILES notation for 3-propoxybuta-1,3-dienylazanium?
The canonical SMILES for 3-propoxybuta-1,3-dienylazanium is C=C(C=C[NH3+])OCCC.
What is the InChIKey of 3-propoxybuta-1,3-dienylazanium?
The InChIKey is HCGAABSDBDGHBV-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H13NO/c1-3-6-9-7(2)4-5-8/h4-5H,2-3,6,8H2,1H3/p+1.
What are the key properties of 3-propoxybuta-1,3-dienylazanium?
3-propoxybuta-1,3-dienylazanium has a molecular weight of 128.19 g/mol, XLogP of 0.68, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propoxybuta-1,3-dienylazanium is sourced from PubChem (CID 20980264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).