C16H26N4O4S-2 — CID 20980716
2-[[2-(azocan-1-ylmethyl)phenyl]methyl]guanidine sulfate (PubChem CID 20980716) has the molecular formula C16H26N4O4S-2 and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-[[2-(azocan-1-ylmethyl)phenyl]methyl]guanidine sulfate.
| Compound Name | 2-[[2-(azocan-1-ylmethyl)phenyl]methyl]guanidine sulfate |
|---|---|
| PubChem CID | 20980716 |
| Molecular Formula | C16H26N4O4S-2 |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 2-[[2-(azocan-1-ylmethyl)phenyl]methyl]guanidine sulfate |
| SMILES | NC(N)=NCc1ccccc1CN1CCCCCCC1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C16H26N4.H2O4S/c17-16(18)19-12-14-8-4-5-9-15(14)13-20-10-6-2-1-3-7-11-20;1-5(2,3)4/h4-5,8-9H,1-3,6-7,10-13H2,(H4,17,18,19);(H2,1,2,3,4)/p-2 |
| InChIKey | SMJIZGHENYCXCJ-UHFFFAOYSA-L |
| XLogP | 0.89 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|