C20H32O — CID 20982009
3,4,5-trimethylheptadeca-2,4,6,8,10-pentaen-2-ol (PubChem CID 20982009) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 3,4,5-trimethylheptadeca-2,4,6,8,10-pentaen-2-ol.
| Compound Name | 3,4,5-trimethylheptadeca-2,4,6,8,10-pentaen-2-ol |
|---|---|
| PubChem CID | 20982009 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 3,4,5-trimethylheptadeca-2,4,6,8,10-pentaen-2-ol |
| SMILES | CCCCCCC=CC=CC=CC(C)=C(C)C(C)=C(C)O |
| InChI | InChI=1S/C20H32O/c1-6-7-8-9-10-11-12-13-14-15-16-17(2)18(3)19(4)20(5)21/h11-16,21H,6-10H2,1-5H3 |
| InChIKey | VNSOUMVJZFCVCM-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|