About 2,2-diethoxypropane;pyrrole-2,5-dione
2,2-diethoxypropane;pyrrole-2,5-dione (PubChem CID 20982125) has the molecular formula C11H19NO4
and a molecular weight of 229.28 g/mol. Its IUPAC name is 2,2-diethoxypropane;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 2,2-diethoxypropane;pyrrole-2,5-dione |
| PubChem CID | 20982125 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 2,2-diethoxypropane;pyrrole-2,5-dione |
| SMILES | CCOC(C)(C)OCC.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C7H16O2.C4H3NO2/c1-5-8-7(3,4)9-6-2;6-3-1-2-4(7)5-3/h5-6H2,1-4H3;1-2H,(H,5,6,7) |
| InChIKey | TZLIIYQHDNANAH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethoxypropane;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethoxypropane;pyrrole-2,5-dione?
The IUPAC name of 2,2-diethoxypropane;pyrrole-2,5-dione (CID 20982125) is 2,2-diethoxypropane;pyrrole-2,5-dione.
What is the SMILES notation for 2,2-diethoxypropane;pyrrole-2,5-dione?
The canonical SMILES for 2,2-diethoxypropane;pyrrole-2,5-dione is CCOC(C)(C)OCC.O=C1C=CC(=O)N1.
What is the InChIKey of 2,2-diethoxypropane;pyrrole-2,5-dione?
The InChIKey is TZLIIYQHDNANAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O2.C4H3NO2/c1-5-8-7(3,4)9-6-2;6-3-1-2-4(7)5-3/h5-6H2,1-4H3;1-2H,(H,5,6,7).
What are the key properties of 2,2-diethoxypropane;pyrrole-2,5-dione?
2,2-diethoxypropane;pyrrole-2,5-dione has a molecular weight of 229.28 g/mol, XLogP of 0.99, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethoxypropane;pyrrole-2,5-dione is sourced from PubChem (CID 20982125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).