C22H20BrN5O5S — CID 20982233
2-[[4-(4-methoxyphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-nitrophenyl)ethanone;hydrate;hydrobromide (PubChem CID 20982233) has the molecular formula C22H20BrN5O5S and a molecular weight of 546.40 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-nitrophenyl)ethanone;hydrate;hydrobromide.
| Compound Name | 2-[[4-(4-methoxyphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-nitrophenyl)ethanone;hydrate;hydrobromide |
|---|---|
| PubChem CID | 20982233 |
| Molecular Formula | C22H20BrN5O5S |
| Molecular Weight | 546.40 g/mol |
| Exact Mass | 545.04 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-nitrophenyl)ethanone;hydrate;hydrobromide |
| SMILES | Br.COc1ccc(-n2c(SCC(=O)c3ccc([N+](=O)[O-])cc3)nnc2-c2ccncc2)cc1.O |
| InChI | InChI=1S/C22H17N5O4S.BrH.H2O/c1-31-19-8-6-17(7-9-19)26-21(16-10-12-23-13-11-16)24-25-22(26)32-14-20(28)15-2-4-18(5-3-15)27(29)30;;/h2-13H,14H2,1H3;1H;1H2 |
| InChIKey | BYMXWRHOEOYMGG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 144.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|