About [1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methanamine
[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methanamine (PubChem CID 20983273) has the molecular formula C13H14Cl2N2
and a molecular weight of 269.18 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methanamine |
| PubChem CID | 20983273 |
| Molecular Formula | C13H14Cl2N2 |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | [1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methanamine |
| SMILES | Cc1cc(CN)c(C)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H14Cl2N2/c1-8-5-10(7-16)9(2)17(8)11-3-4-12(14)13(15)6-11/h3-6H,7,16H2,1-2H3 |
| InChIKey | JHFWRLQZNGNDJA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze [1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methanamine?
The IUPAC name of [1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methanamine (CID 20983273) is [1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methanamine.
What is the SMILES notation for [1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methanamine?
The canonical SMILES for [1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methanamine is Cc1cc(CN)c(C)n1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of [1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methanamine?
The InChIKey is JHFWRLQZNGNDJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2N2/c1-8-5-10(7-16)9(2)17(8)11-3-4-12(14)13(15)6-11/h3-6H,7,16H2,1-2H3.
What are the key properties of [1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methanamine?
[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methanamine has a molecular weight of 269.18 g/mol, XLogP of 3.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methanamine is sourced from PubChem (CID 20983273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).