About 5-amino-3-(3,5-diethoxyphenyl)-1,2-oxazole-4-carbonitrile
5-amino-3-(3,5-diethoxyphenyl)-1,2-oxazole-4-carbonitrile (PubChem CID 20983363) has the molecular formula C14H15N3O3
and a molecular weight of 273.29 g/mol. Its IUPAC name is 5-amino-3-(3,5-diethoxyphenyl)-1,2-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-3-(3,5-diethoxyphenyl)-1,2-oxazole-4-carbonitrile |
| PubChem CID | 20983363 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 5-amino-3-(3,5-diethoxyphenyl)-1,2-oxazole-4-carbonitrile |
| SMILES | CCOc1cc(OCC)cc(-c2noc(N)c2C#N)c1 |
| InChI | InChI=1S/C14H15N3O3/c1-3-18-10-5-9(6-11(7-10)19-4-2)13-12(8-15)14(16)20-17-13/h5-7H,3-4,16H2,1-2H3 |
| InChIKey | YQESTDNRDBDHIF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-3-(3,5-diethoxyphenyl)-1,2-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-(3,5-diethoxyphenyl)-1,2-oxazole-4-carbonitrile?
The IUPAC name of 5-amino-3-(3,5-diethoxyphenyl)-1,2-oxazole-4-carbonitrile (CID 20983363) is 5-amino-3-(3,5-diethoxyphenyl)-1,2-oxazole-4-carbonitrile.
What is the SMILES notation for 5-amino-3-(3,5-diethoxyphenyl)-1,2-oxazole-4-carbonitrile?
The canonical SMILES for 5-amino-3-(3,5-diethoxyphenyl)-1,2-oxazole-4-carbonitrile is CCOc1cc(OCC)cc(-c2noc(N)c2C#N)c1.
What is the InChIKey of 5-amino-3-(3,5-diethoxyphenyl)-1,2-oxazole-4-carbonitrile?
The InChIKey is YQESTDNRDBDHIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O3/c1-3-18-10-5-9(6-11(7-10)19-4-2)13-12(8-15)14(16)20-17-13/h5-7H,3-4,16H2,1-2H3.
What are the key properties of 5-amino-3-(3,5-diethoxyphenyl)-1,2-oxazole-4-carbonitrile?
5-amino-3-(3,5-diethoxyphenyl)-1,2-oxazole-4-carbonitrile has a molecular weight of 273.29 g/mol, XLogP of 2.59, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-(3,5-diethoxyphenyl)-1,2-oxazole-4-carbonitrile is sourced from PubChem (CID 20983363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).