C13H14N2S — CID 20983466
2-methyl-4-(1,2,3,4-tetrahydroquinolin-6-yl)-1,3-thiazole (PubChem CID 20983466) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is 2-methyl-4-(1,2,3,4-tetrahydroquinolin-6-yl)-1,3-thiazole.
| Compound Name | 2-methyl-4-(1,2,3,4-tetrahydroquinolin-6-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 20983466 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-methyl-4-(1,2,3,4-tetrahydroquinolin-6-yl)-1,3-thiazole |
| SMILES | Cc1nc(-c2ccc3c(c2)CCCN3)cs1 |
| InChI | InChI=1S/C13H14N2S/c1-9-15-13(8-16-9)11-4-5-12-10(7-11)3-2-6-14-12/h4-5,7-8,14H,2-3,6H2,1H3 |
| InChIKey | NXWRJLWVUKLXCW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |