C13H12N4O2S — CID 20983675
7-(2-amino-5-methyl-1,3-thiazol-4-yl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione (PubChem CID 20983675) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is 7-(2-amino-5-methyl-1,3-thiazol-4-yl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione.
| Compound Name | 7-(2-amino-5-methyl-1,3-thiazol-4-yl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 20983675 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 7-(2-amino-5-methyl-1,3-thiazol-4-yl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
| SMILES | Cc1sc(N)nc1-c1ccc2c(c1)NC(=O)CC(=O)N2 |
| InChI | InChI=1S/C13H12N4O2S/c1-6-12(17-13(14)20-6)7-2-3-8-9(4-7)16-11(19)5-10(18)15-8/h2-4H,5H2,1H3,(H2,14,17)(H,15,18)(H,16,19) |
| InChIKey | QWFOKAXAEDRPMH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|