About 2-[2-[(4-fluorophenyl)methoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride
2-[2-[(4-fluorophenyl)methoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride (PubChem CID 20984128) has the molecular formula C17H13ClFNO3S2
and a molecular weight of 397.88 g/mol. Its IUPAC name is 2-[2-[(4-fluorophenyl)methoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-[2-[(4-fluorophenyl)methoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride |
| PubChem CID | 20984128 |
| Molecular Formula | C17H13ClFNO3S2 |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | 2-[2-[(4-fluorophenyl)methoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride |
| SMILES | Cc1nc(-c2ccccc2OCc2ccc(F)cc2)sc1S(=O)(=O)Cl |
| InChI | InChI=1S/C17H13ClFNO3S2/c1-11-17(25(18,21)22)24-16(20-11)14-4-2-3-5-15(14)23-10-12-6-8-13(19)9-7-12/h2-9H,10H2,1H3 |
| InChIKey | HPTJZRIMTNKPTD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[(4-fluorophenyl)methoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(4-fluorophenyl)methoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride?
The IUPAC name of 2-[2-[(4-fluorophenyl)methoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride (CID 20984128) is 2-[2-[(4-fluorophenyl)methoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride.
What is the SMILES notation for 2-[2-[(4-fluorophenyl)methoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride?
The canonical SMILES for 2-[2-[(4-fluorophenyl)methoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride is Cc1nc(-c2ccccc2OCc2ccc(F)cc2)sc1S(=O)(=O)Cl.
What is the InChIKey of 2-[2-[(4-fluorophenyl)methoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride?
The InChIKey is HPTJZRIMTNKPTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClFNO3S2/c1-11-17(25(18,21)22)24-16(20-11)14-4-2-3-5-15(14)23-10-12-6-8-13(19)9-7-12/h2-9H,10H2,1H3.
What are the key properties of 2-[2-[(4-fluorophenyl)methoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride?
2-[2-[(4-fluorophenyl)methoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride has a molecular weight of 397.88 g/mol, XLogP of 4.76, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(4-fluorophenyl)methoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride is sourced from PubChem (CID 20984128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).