About 2-(3-chloro-4,5-diethoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride
2-(3-chloro-4,5-diethoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride (PubChem CID 20984453) has the molecular formula C14H15Cl2NO4S2
and a molecular weight of 396.32 g/mol. Its IUPAC name is 2-(3-chloro-4,5-diethoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-(3-chloro-4,5-diethoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride |
| PubChem CID | 20984453 |
| Molecular Formula | C14H15Cl2NO4S2 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | 2-(3-chloro-4,5-diethoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride |
| SMILES | CCOc1cc(-c2nc(C)c(S(=O)(=O)Cl)s2)cc(Cl)c1OCC |
| InChI | InChI=1S/C14H15Cl2NO4S2/c1-4-20-11-7-9(6-10(15)12(11)21-5-2)13-17-8(3)14(22-13)23(16,18)19/h6-7H,4-5H2,1-3H3 |
| InChIKey | YLWUKZAJLFJFGS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-chloro-4,5-diethoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-4,5-diethoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride?
The IUPAC name of 2-(3-chloro-4,5-diethoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride (CID 20984453) is 2-(3-chloro-4,5-diethoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride.
What is the SMILES notation for 2-(3-chloro-4,5-diethoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride?
The canonical SMILES for 2-(3-chloro-4,5-diethoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride is CCOc1cc(-c2nc(C)c(S(=O)(=O)Cl)s2)cc(Cl)c1OCC.
What is the InChIKey of 2-(3-chloro-4,5-diethoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride?
The InChIKey is YLWUKZAJLFJFGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2NO4S2/c1-4-20-11-7-9(6-10(15)12(11)21-5-2)13-17-8(3)14(22-13)23(16,18)19/h6-7H,4-5H2,1-3H3.
What are the key properties of 2-(3-chloro-4,5-diethoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride?
2-(3-chloro-4,5-diethoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride has a molecular weight of 396.32 g/mol, XLogP of 4.50, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-4,5-diethoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride is sourced from PubChem (CID 20984453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).