C18H17ClN2O3 — CID 20985280
N-[[4-[2-(4-chlorophenoxy)ethoxy]phenyl]methyl]-2-cyanoacetamide (PubChem CID 20985280) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is N-[[4-[2-(4-chlorophenoxy)ethoxy]phenyl]methyl]-2-cyanoacetamide.
| Compound Name | N-[[4-[2-(4-chlorophenoxy)ethoxy]phenyl]methyl]-2-cyanoacetamide |
|---|---|
| PubChem CID | 20985280 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-[[4-[2-(4-chlorophenoxy)ethoxy]phenyl]methyl]-2-cyanoacetamide |
| SMILES | N#CCC(=O)NCc1ccc(OCCOc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H17ClN2O3/c19-15-3-7-17(8-4-15)24-12-11-23-16-5-1-14(2-6-16)13-21-18(22)9-10-20/h1-8H,9,11-13H2,(H,21,22) |
| InChIKey | SWZZYKOQZUZIJB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|