C22H19ClN2O2 — CID 20985777
N-[2-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]ethyl]-2-cyanoacetamide (PubChem CID 20985777) has the molecular formula C22H19ClN2O2 and a molecular weight of 378.86 g/mol. Its IUPAC name is N-[2-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]ethyl]-2-cyanoacetamide.
| Compound Name | N-[2-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]ethyl]-2-cyanoacetamide |
|---|---|
| PubChem CID | 20985777 |
| Molecular Formula | C22H19ClN2O2 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-[2-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]ethyl]-2-cyanoacetamide |
| SMILES | N#CCC(=O)NCCc1c(OCc2ccccc2Cl)ccc2ccccc12 |
| InChI | InChI=1S/C22H19ClN2O2/c23-20-8-4-2-6-17(20)15-27-21-10-9-16-5-1-3-7-18(16)19(21)12-14-25-22(26)11-13-24/h1-10H,11-12,14-15H2,(H,25,26) |
| InChIKey | XPTWKMYFRGPPBU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |