C19H28N2O4 — CID 20986229
4-oxo-4-[2-[4-(2-piperidin-1-ylethoxy)phenyl]ethylamino]butanoic acid (PubChem CID 20986229) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 4-oxo-4-[2-[4-(2-piperidin-1-ylethoxy)phenyl]ethylamino]butanoic acid.
| Compound Name | 4-oxo-4-[2-[4-(2-piperidin-1-ylethoxy)phenyl]ethylamino]butanoic acid |
|---|---|
| PubChem CID | 20986229 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 4-oxo-4-[2-[4-(2-piperidin-1-ylethoxy)phenyl]ethylamino]butanoic acid |
| SMILES | O=C(O)CCC(=O)NCCc1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C19H28N2O4/c22-18(8-9-19(23)24)20-11-10-16-4-6-17(7-5-16)25-15-14-21-12-2-1-3-13-21/h4-7H,1-3,8-15H2,(H,20,22)(H,23,24) |
| InChIKey | JVBFZRZHGJMEGT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |