C21H16ClNO4 — CID 20986440
2-[[4-[(2-chlorophenyl)carbamoyl]phenoxy]methyl]benzoic acid (PubChem CID 20986440) has the molecular formula C21H16ClNO4 and a molecular weight of 381.82 g/mol. Its IUPAC name is 2-[[4-[(2-chlorophenyl)carbamoyl]phenoxy]methyl]benzoic acid.
| Compound Name | 2-[[4-[(2-chlorophenyl)carbamoyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 20986440 |
| Molecular Formula | C21H16ClNO4 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2-[[4-[(2-chlorophenyl)carbamoyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(Nc1ccccc1Cl)c1ccc(OCc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H16ClNO4/c22-18-7-3-4-8-19(18)23-20(24)14-9-11-16(12-10-14)27-13-15-5-1-2-6-17(15)21(25)26/h1-12H,13H2,(H,23,24)(H,25,26) |
| InChIKey | KQUZNYRYGFNALE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |