About 3-[(1,1-dioxothiolan-3-yl)-(3-methoxypropyl)amino]-2,2-dimethylpropanoic acid
3-[(1,1-dioxothiolan-3-yl)-(3-methoxypropyl)amino]-2,2-dimethylpropanoic acid (PubChem CID 20986461) has the molecular formula C13H25NO5S
and a molecular weight of 307.41 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)-(3-methoxypropyl)amino]-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)-(3-methoxypropyl)amino]-2,2-dimethylpropanoic acid |
| PubChem CID | 20986461 |
| Molecular Formula | C13H25NO5S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)-(3-methoxypropyl)amino]-2,2-dimethylpropanoic acid |
| SMILES | COCCCN(CC(C)(C)C(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H25NO5S/c1-13(2,12(15)16)10-14(6-4-7-19-3)11-5-8-20(17,18)9-11/h11H,4-10H2,1-3H3,(H,15,16) |
| InChIKey | YVVRBFAWPUNRQO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1,1-dioxothiolan-3-yl)-(3-methoxypropyl)amino]-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-dioxothiolan-3-yl)-(3-methoxypropyl)amino]-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[(1,1-dioxothiolan-3-yl)-(3-methoxypropyl)amino]-2,2-dimethylpropanoic acid (CID 20986461) is 3-[(1,1-dioxothiolan-3-yl)-(3-methoxypropyl)amino]-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[(1,1-dioxothiolan-3-yl)-(3-methoxypropyl)amino]-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[(1,1-dioxothiolan-3-yl)-(3-methoxypropyl)amino]-2,2-dimethylpropanoic acid is COCCCN(CC(C)(C)C(=O)O)C1CCS(=O)(=O)C1.
What is the InChIKey of 3-[(1,1-dioxothiolan-3-yl)-(3-methoxypropyl)amino]-2,2-dimethylpropanoic acid?
The InChIKey is YVVRBFAWPUNRQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO5S/c1-13(2,12(15)16)10-14(6-4-7-19-3)11-5-8-20(17,18)9-11/h11H,4-10H2,1-3H3,(H,15,16).
What are the key properties of 3-[(1,1-dioxothiolan-3-yl)-(3-methoxypropyl)amino]-2,2-dimethylpropanoic acid?
3-[(1,1-dioxothiolan-3-yl)-(3-methoxypropyl)amino]-2,2-dimethylpropanoic acid has a molecular weight of 307.41 g/mol, XLogP of 0.62, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxothiolan-3-yl)-(3-methoxypropyl)amino]-2,2-dimethylpropanoic acid is sourced from PubChem (CID 20986461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).