C19H22O4 — CID 20987714
3-[3-[2-(4-ethylphenoxy)ethoxy]phenyl]propanoic acid (PubChem CID 20987714) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-[3-[2-(4-ethylphenoxy)ethoxy]phenyl]propanoic acid.
| Compound Name | 3-[3-[2-(4-ethylphenoxy)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 20987714 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-[3-[2-(4-ethylphenoxy)ethoxy]phenyl]propanoic acid |
| SMILES | CCc1ccc(OCCOc2cccc(CCC(=O)O)c2)cc1 |
| InChI | InChI=1S/C19H22O4/c1-2-15-6-9-17(10-7-15)22-12-13-23-18-5-3-4-16(14-18)8-11-19(20)21/h3-7,9-10,14H,2,8,11-13H2,1H3,(H,20,21) |
| InChIKey | XDGJFYWVYYWIMW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|