About (1-methylpiperidin-4-yl) 4-(butylamino)-2-chlorobenzoate
(1-methylpiperidin-4-yl) 4-(butylamino)-2-chlorobenzoate (PubChem CID 20989) has the molecular formula C17H25ClN2O2
and a molecular weight of 324.85 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 4-(butylamino)-2-chlorobenzoate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) 4-(butylamino)-2-chlorobenzoate |
| PubChem CID | 20989 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (1-methylpiperidin-4-yl) 4-(butylamino)-2-chlorobenzoate |
| SMILES | CCCCNc1ccc(C(=O)OC2CCN(C)CC2)c(Cl)c1 |
| InChI | InChI=1S/C17H25ClN2O2/c1-3-4-9-19-13-5-6-15(16(18)12-13)17(21)22-14-7-10-20(2)11-8-14/h5-6,12,14,19H,3-4,7-11H2,1-2H3 |
| InChIKey | WROMRZIXHGGSBM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpiperidin-4-yl) 4-(butylamino)-2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) 4-(butylamino)-2-chlorobenzoate?
The IUPAC name of (1-methylpiperidin-4-yl) 4-(butylamino)-2-chlorobenzoate (CID 20989) is (1-methylpiperidin-4-yl) 4-(butylamino)-2-chlorobenzoate.
What is the SMILES notation for (1-methylpiperidin-4-yl) 4-(butylamino)-2-chlorobenzoate?
The canonical SMILES for (1-methylpiperidin-4-yl) 4-(butylamino)-2-chlorobenzoate is CCCCNc1ccc(C(=O)OC2CCN(C)CC2)c(Cl)c1.
What is the InChIKey of (1-methylpiperidin-4-yl) 4-(butylamino)-2-chlorobenzoate?
The InChIKey is WROMRZIXHGGSBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25ClN2O2/c1-3-4-9-19-13-5-6-15(16(18)12-13)17(21)22-14-7-10-20(2)11-8-14/h5-6,12,14,19H,3-4,7-11H2,1-2H3.
What are the key properties of (1-methylpiperidin-4-yl) 4-(butylamino)-2-chlorobenzoate?
(1-methylpiperidin-4-yl) 4-(butylamino)-2-chlorobenzoate has a molecular weight of 324.85 g/mol, XLogP of 3.80, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) 4-(butylamino)-2-chlorobenzoate is sourced from PubChem (CID 20989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).