C16H22F3N3O2 — CID 2098901
2-[[(2R)-1-ethylpyrrolidin-2-yl]methylamino]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 2098901) has the molecular formula C16H22F3N3O2 and a molecular weight of 345.37 g/mol. Its IUPAC name is 2-[[(2R)-1-ethylpyrrolidin-2-yl]methylamino]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[[(2R)-1-ethylpyrrolidin-2-yl]methylamino]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 2098901 |
| Molecular Formula | C16H22F3N3O2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-[[(2R)-1-ethylpyrrolidin-2-yl]methylamino]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | CCN1CCC[C@@H]1CNCC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H22F3N3O2/c1-2-22-9-3-4-13(22)10-20-11-15(23)21-12-5-7-14(8-6-12)24-16(17,18)19/h5-8,13,20H,2-4,9-11H2,1H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | VHZCEHVYTHWFHP-CYBMUJFWSA-N |
| XLogP | 2.60 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |