C18H22N2O4 — CID 20989921
5-[1-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]furan-2-carboxylic acid (PubChem CID 20989921) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 5-[1-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]furan-2-carboxylic acid.
| Compound Name | 5-[1-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 20989921 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 5-[1-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]furan-2-carboxylic acid |
| SMILES | COc1ccccc1N1CCN(C(C)c2ccc(C(=O)O)o2)CC1 |
| InChI | InChI=1S/C18H22N2O4/c1-13(15-7-8-17(24-15)18(21)22)19-9-11-20(12-10-19)14-5-3-4-6-16(14)23-2/h3-8,13H,9-12H2,1-2H3,(H,21,22) |
| InChIKey | IZCMHYDGOLZVLP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |