C22H23NO4S — CID 20990507
2-[4-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]-4-ethyl-1,3-thiazole-5-carboxylic acid (PubChem CID 20990507) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-[4-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]-4-ethyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[4-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]-4-ethyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 20990507 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-[4-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]-4-ethyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CCc1nc(-c2ccc(OCCOc3cc(C)ccc3C)cc2)sc1C(=O)O |
| InChI | InChI=1S/C22H23NO4S/c1-4-18-20(22(24)25)28-21(23-18)16-7-9-17(10-8-16)26-11-12-27-19-13-14(2)5-6-15(19)3/h5-10,13H,4,11-12H2,1-3H3,(H,24,25) |
| InChIKey | SQQGCYWHFHTLJB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|