C17H17ClO3 — CID 20992054
5-chloro-2-[2-(2,5-dimethylphenoxy)ethoxy]benzaldehyde (PubChem CID 20992054) has the molecular formula C17H17ClO3 and a molecular weight of 304.77 g/mol. Its IUPAC name is 5-chloro-2-[2-(2,5-dimethylphenoxy)ethoxy]benzaldehyde.
| Compound Name | 5-chloro-2-[2-(2,5-dimethylphenoxy)ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 20992054 |
| Molecular Formula | C17H17ClO3 |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 5-chloro-2-[2-(2,5-dimethylphenoxy)ethoxy]benzaldehyde |
| SMILES | Cc1ccc(C)c(OCCOc2ccc(Cl)cc2C=O)c1 |
| InChI | InChI=1S/C17H17ClO3/c1-12-3-4-13(2)17(9-12)21-8-7-20-16-6-5-15(18)10-14(16)11-19/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | PNBKJYGRLZODGD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|