3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid

C9H17NO4S — CID 20992494

IUPAC3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid
SMILESCCN(CCC(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C9H17NO4S/c1-2-10(5-3-9(11)12)8-4-6-15(13,14)7-8/h8H,2-7H2,1H3,(H,11,12)
InChIKeyTXMBHJZZALSTEN-UHFFFAOYSA-N
MW235.30 g/mol
LogP-0.03
Rot. Bonds5

About 3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid

3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid (PubChem CID 20992494) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid.

Molecular Properties

Compound Name3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid
PubChem CID20992494
Molecular FormulaC9H17NO4S
Molecular Weight235.30 g/mol
Exact Mass235.09
IUPAC Name3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid
SMILESCCN(CCC(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C9H17NO4S/c1-2-10(5-3-9(11)12)8-4-6-15(13,14)7-8/h8H,2-7H2,1H3,(H,11,12)
InChIKeyTXMBHJZZALSTEN-UHFFFAOYSA-N
XLogP-0.03
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.30
LogP ≤ 5-0.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid?
The IUPAC name of 3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid (CID 20992494) is 3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid.
What is the SMILES notation for 3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid?
The canonical SMILES for 3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid is CCN(CCC(=O)O)C1CCS(=O)(=O)C1.
What is the InChIKey of 3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid?
The InChIKey is TXMBHJZZALSTEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4S/c1-2-10(5-3-9(11)12)8-4-6-15(13,14)7-8/h8H,2-7H2,1H3,(H,11,12).
What are the key properties of 3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid?
3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid has a molecular weight of 235.30 g/mol, XLogP of -0.03, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxothiolan-3-yl)-ethylamino]propanoic acid is sourced from PubChem (CID 20992494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).