About (4-methoxycarbonyl-5-methylfuran-2-yl)methyl quinoline-2-carboxylate
(4-methoxycarbonyl-5-methylfuran-2-yl)methyl quinoline-2-carboxylate (PubChem CID 2099355) has the molecular formula C18H15NO5
and a molecular weight of 325.32 g/mol. Its IUPAC name is (4-methoxycarbonyl-5-methylfuran-2-yl)methyl quinoline-2-carboxylate.
Molecular Properties
| Compound Name | (4-methoxycarbonyl-5-methylfuran-2-yl)methyl quinoline-2-carboxylate |
| PubChem CID | 2099355 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (4-methoxycarbonyl-5-methylfuran-2-yl)methyl quinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(COC(=O)c2ccc3ccccc3n2)oc1C |
| InChI | InChI=1S/C18H15NO5/c1-11-14(17(20)22-2)9-13(24-11)10-23-18(21)16-8-7-12-5-3-4-6-15(12)19-16/h3-9H,10H2,1-2H3 |
| InChIKey | YHEASMSYCBJLMI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-methoxycarbonyl-5-methylfuran-2-yl)methyl quinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxycarbonyl-5-methylfuran-2-yl)methyl quinoline-2-carboxylate?
The IUPAC name of (4-methoxycarbonyl-5-methylfuran-2-yl)methyl quinoline-2-carboxylate (CID 2099355) is (4-methoxycarbonyl-5-methylfuran-2-yl)methyl quinoline-2-carboxylate.
What is the SMILES notation for (4-methoxycarbonyl-5-methylfuran-2-yl)methyl quinoline-2-carboxylate?
The canonical SMILES for (4-methoxycarbonyl-5-methylfuran-2-yl)methyl quinoline-2-carboxylate is COC(=O)c1cc(COC(=O)c2ccc3ccccc3n2)oc1C.
What is the InChIKey of (4-methoxycarbonyl-5-methylfuran-2-yl)methyl quinoline-2-carboxylate?
The InChIKey is YHEASMSYCBJLMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO5/c1-11-14(17(20)22-2)9-13(24-11)10-23-18(21)16-8-7-12-5-3-4-6-15(12)19-16/h3-9H,10H2,1-2H3.
What are the key properties of (4-methoxycarbonyl-5-methylfuran-2-yl)methyl quinoline-2-carboxylate?
(4-methoxycarbonyl-5-methylfuran-2-yl)methyl quinoline-2-carboxylate has a molecular weight of 325.32 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxycarbonyl-5-methylfuran-2-yl)methyl quinoline-2-carboxylate is sourced from PubChem (CID 2099355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).