C24H21ClN2O3 — CID 20994682
8-chloro-4-(4-ethoxybenzoyl)-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one (PubChem CID 20994682) has the molecular formula C24H21ClN2O3 and a molecular weight of 420.90 g/mol. Its IUPAC name is 8-chloro-4-(4-ethoxybenzoyl)-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one.
| Compound Name | 8-chloro-4-(4-ethoxybenzoyl)-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 20994682 |
| Molecular Formula | C24H21ClN2O3 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 8-chloro-4-(4-ethoxybenzoyl)-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
| SMILES | CCOc1ccc(C(=O)N2CC(=O)Nc3cc(Cl)ccc3C2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21ClN2O3/c1-2-30-19-11-8-17(9-12-19)24(29)27-15-22(28)26-21-14-18(25)10-13-20(21)23(27)16-6-4-3-5-7-16/h3-14,23H,2,15H2,1H3,(H,26,28) |
| InChIKey | JXHXNSWDFORSNJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |