C22H25FN2O4 — CID 20994857
1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]-2-[2-(2-fluorophenoxy)ethylamino]ethanone (PubChem CID 20994857) has the molecular formula C22H25FN2O4 and a molecular weight of 400.45 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]-2-[2-(2-fluorophenoxy)ethylamino]ethanone.
| Compound Name | 1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]-2-[2-(2-fluorophenoxy)ethylamino]ethanone |
|---|---|
| PubChem CID | 20994857 |
| Molecular Formula | C22H25FN2O4 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]-2-[2-(2-fluorophenoxy)ethylamino]ethanone |
| SMILES | O=C(CNCCOc1ccccc1F)N1CCCC1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H25FN2O4/c23-17-4-1-2-6-19(17)27-11-9-24-15-22(26)25-10-3-5-18(25)16-7-8-20-21(14-16)29-13-12-28-20/h1-2,4,6-8,14,18,24H,3,5,9-13,15H2 |
| InChIKey | CLOAMGJHTVGZAF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|