C21H26N2O5 — CID 20994914
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-N-ethylacetamide (PubChem CID 20994914) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-N-ethylacetamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 20994914 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-N-ethylacetamide |
| SMILES | CCN(Cc1ccc2c(c1)OCCO2)C(=O)CN1C(=O)CC2(CCCC2)C1=O |
| InChI | InChI=1S/C21H26N2O5/c1-2-22(13-15-5-6-16-17(11-15)28-10-9-27-16)19(25)14-23-18(24)12-21(20(23)26)7-3-4-8-21/h5-6,11H,2-4,7-10,12-14H2,1H3 |
| InChIKey | CFEAMAIQPZMKQG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|