C18H29ClN2O3 — CID 20995004
N-[[1-(dimethylamino)cyclohexyl]methyl]-2-(2-methoxyphenoxy)acetamide;hydrochloride (PubChem CID 20995004) has the molecular formula C18H29ClN2O3 and a molecular weight of 356.89 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclohexyl]methyl]-2-(2-methoxyphenoxy)acetamide;hydrochloride.
| Compound Name | N-[[1-(dimethylamino)cyclohexyl]methyl]-2-(2-methoxyphenoxy)acetamide;hydrochloride |
|---|---|
| PubChem CID | 20995004 |
| Molecular Formula | C18H29ClN2O3 |
| Molecular Weight | 356.89 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-[[1-(dimethylamino)cyclohexyl]methyl]-2-(2-methoxyphenoxy)acetamide;hydrochloride |
| SMILES | COc1ccccc1OCC(=O)NCC1(N(C)C)CCCCC1.Cl |
| InChI | InChI=1S/C18H28N2O3.ClH/c1-20(2)18(11-7-4-8-12-18)14-19-17(21)13-23-16-10-6-5-9-15(16)22-3;/h5-6,9-10H,4,7-8,11-14H2,1-3H3,(H,19,21);1H |
| InChIKey | RDHQVBLAPUZOKK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.89 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |