C14H20N2O6S2 — CID 20995624
N-(2-methoxyethyl)-2,6-dimethyl-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide (PubChem CID 20995624) has the molecular formula C14H20N2O6S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2,6-dimethyl-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide.
| Compound Name | N-(2-methoxyethyl)-2,6-dimethyl-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 20995624 |
| Molecular Formula | C14H20N2O6S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | N-(2-methoxyethyl)-2,6-dimethyl-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1c(C)cc(N2C(=O)CCS2(=O)=O)cc1C |
| InChI | InChI=1S/C14H20N2O6S2/c1-10-8-12(16-13(17)4-7-23(16,18)19)9-11(2)14(10)24(20,21)15-5-6-22-3/h8-9,15H,4-7H2,1-3H3 |
| InChIKey | NIGXLERUERQTIN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|