About N-(furan-2-ylmethyl)-2-(4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide
N-(furan-2-ylmethyl)-2-(4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide (PubChem CID 20995892) has the molecular formula C14H12N2O2S2
and a molecular weight of 304.40 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(furan-2-ylmethyl)-2-(4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide |
| PubChem CID | 20995892 |
| Molecular Formula | C14H12N2O2S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide |
| SMILES | O=C(Cc1scnc1-c1cccs1)NCc1ccco1 |
| InChI | InChI=1S/C14H12N2O2S2/c17-13(15-8-10-3-1-5-18-10)7-12-14(16-9-20-12)11-4-2-6-19-11/h1-6,9H,7-8H2,(H,15,17) |
| InChIKey | LBPUWYWHMQOOTD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(furan-2-ylmethyl)-2-(4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-2-(4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide?
The IUPAC name of N-(furan-2-ylmethyl)-2-(4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide (CID 20995892) is N-(furan-2-ylmethyl)-2-(4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide.
What is the SMILES notation for N-(furan-2-ylmethyl)-2-(4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide?
The canonical SMILES for N-(furan-2-ylmethyl)-2-(4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide is O=C(Cc1scnc1-c1cccs1)NCc1ccco1.
What is the InChIKey of N-(furan-2-ylmethyl)-2-(4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide?
The InChIKey is LBPUWYWHMQOOTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2S2/c17-13(15-8-10-3-1-5-18-10)7-12-14(16-9-20-12)11-4-2-6-19-11/h1-6,9H,7-8H2,(H,15,17).
What are the key properties of N-(furan-2-ylmethyl)-2-(4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide?
N-(furan-2-ylmethyl)-2-(4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide has a molecular weight of 304.40 g/mol, XLogP of 3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-2-(4-thiophen-2-yl-1,3-thiazol-5-yl)acetamide is sourced from PubChem (CID 20995892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).