About 1-methylsulfonyl-2,3-dihydropyrrolo[2,3-b]quinoline
1-methylsulfonyl-2,3-dihydropyrrolo[2,3-b]quinoline (PubChem CID 20996186) has the molecular formula C12H12N2O2S
and a molecular weight of 248.31 g/mol. Its IUPAC name is 1-methylsulfonyl-2,3-dihydropyrrolo[2,3-b]quinoline.
Molecular Properties
| Compound Name | 1-methylsulfonyl-2,3-dihydropyrrolo[2,3-b]quinoline |
| PubChem CID | 20996186 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 1-methylsulfonyl-2,3-dihydropyrrolo[2,3-b]quinoline |
| SMILES | CS(=O)(=O)N1CCc2cc3ccccc3nc21 |
| InChI | InChI=1S/C12H12N2O2S/c1-17(15,16)14-7-6-10-8-9-4-2-3-5-11(9)13-12(10)14/h2-5,8H,6-7H2,1H3 |
| InChIKey | LJDJZHSUPZGPBL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylsulfonyl-2,3-dihydropyrrolo[2,3-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfonyl-2,3-dihydropyrrolo[2,3-b]quinoline?
The IUPAC name of 1-methylsulfonyl-2,3-dihydropyrrolo[2,3-b]quinoline (CID 20996186) is 1-methylsulfonyl-2,3-dihydropyrrolo[2,3-b]quinoline.
What is the SMILES notation for 1-methylsulfonyl-2,3-dihydropyrrolo[2,3-b]quinoline?
The canonical SMILES for 1-methylsulfonyl-2,3-dihydropyrrolo[2,3-b]quinoline is CS(=O)(=O)N1CCc2cc3ccccc3nc21.
What is the InChIKey of 1-methylsulfonyl-2,3-dihydropyrrolo[2,3-b]quinoline?
The InChIKey is LJDJZHSUPZGPBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S/c1-17(15,16)14-7-6-10-8-9-4-2-3-5-11(9)13-12(10)14/h2-5,8H,6-7H2,1H3.
What are the key properties of 1-methylsulfonyl-2,3-dihydropyrrolo[2,3-b]quinoline?
1-methylsulfonyl-2,3-dihydropyrrolo[2,3-b]quinoline has a molecular weight of 248.31 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfonyl-2,3-dihydropyrrolo[2,3-b]quinoline is sourced from PubChem (CID 20996186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).