C19H17ClN4 — CID 20997764
2-[[2-methyl-6-(4-methylphenyl)pyrimidin-4-yl]amino]benzonitrile;hydrochloride (PubChem CID 20997764) has the molecular formula C19H17ClN4 and a molecular weight of 336.83 g/mol. Its IUPAC name is 2-[[2-methyl-6-(4-methylphenyl)pyrimidin-4-yl]amino]benzonitrile;hydrochloride.
| Compound Name | 2-[[2-methyl-6-(4-methylphenyl)pyrimidin-4-yl]amino]benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 20997764 |
| Molecular Formula | C19H17ClN4 |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-[[2-methyl-6-(4-methylphenyl)pyrimidin-4-yl]amino]benzonitrile;hydrochloride |
| SMILES | Cc1ccc(-c2cc(Nc3ccccc3C#N)nc(C)n2)cc1.Cl |
| InChI | InChI=1S/C19H16N4.ClH/c1-13-7-9-15(10-8-13)18-11-19(22-14(2)21-18)23-17-6-4-3-5-16(17)12-20;/h3-11H,1-2H3,(H,21,22,23);1H |
| InChIKey | GLPGIESRUOVUFH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |