C20H18Cl2N4O3S — CID 20998134
[2-methoxy-4-[(E)-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 20998134) has the molecular formula C20H18Cl2N4O3S and a molecular weight of 465.36 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-methoxy-4-[(E)-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 20998134 |
| Molecular Formula | C20H18Cl2N4O3S |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | [2-methoxy-4-[(E)-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | CCCc1n[nH]c(=S)n1/N=C/c1ccc(OC(=O)c2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C20H18Cl2N4O3S/c1-3-4-18-24-25-20(30)26(18)23-11-12-5-8-16(17(9-12)28-2)29-19(27)14-7-6-13(21)10-15(14)22/h5-11H,3-4H2,1-2H3,(H,25,30)/b23-11+ |
| InChIKey | ZGPGFTLASANXSS-FOKLQQMPSA-N |
| XLogP | 5.31 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|