About [2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate
[2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 20998453) has the molecular formula C30H27NO5
and a molecular weight of 481.55 g/mol. Its IUPAC name is [2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate.
Molecular Properties
| Compound Name | [2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
| PubChem CID | 20998453 |
| Molecular Formula | C30H27NO5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(C)(C)c1ccc(/C=C/C(=O)c2ccccc2OC(=O)CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C30H27NO5/c1-30(2,3)21-15-12-20(13-16-21)14-17-25(32)24-10-6-7-11-26(24)36-27(33)18-19-31-28(34)22-8-4-5-9-23(22)29(31)35/h4-17H,18-19H2,1-3H3/b17-14+ |
| InChIKey | FSDFJVWWIQXQFS-SAPNQHFASA-N |
| XLogP | 5.47 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate?
The IUPAC name of [2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate (CID 20998453) is [2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate.
What is the SMILES notation for [2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate?
The canonical SMILES for [2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate is CC(C)(C)c1ccc(/C=C/C(=O)c2ccccc2OC(=O)CCN2C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of [2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate?
The InChIKey is FSDFJVWWIQXQFS-SAPNQHFASA-N. The full InChI is InChI=1S/C30H27NO5/c1-30(2,3)21-15-12-20(13-16-21)14-17-25(32)24-10-6-7-11-26(24)36-27(33)18-19-31-28(34)22-8-4-5-9-23(22)29(31)35/h4-17H,18-19H2,1-3H3/b17-14+.
What are the key properties of [2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate?
[2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate has a molecular weight of 481.55 g/mol, XLogP of 5.47, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate is sourced from PubChem (CID 20998453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).