About 1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene
1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene (PubChem CID 2099931) has the molecular formula C9H4F8O
and a molecular weight of 280.11 g/mol. Its IUPAC name is 1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene |
| PubChem CID | 2099931 |
| Molecular Formula | C9H4F8O |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene |
| SMILES | FC(F)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H4F8O/c10-7(11)18-6-2-4(8(12,13)14)1-5(3-6)9(15,16)17/h1-3,7H |
| InChIKey | MHKACPMSUQVVBH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene?
The IUPAC name of 1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene (CID 2099931) is 1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene.
What is the SMILES notation for 1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene?
The canonical SMILES for 1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene is FC(F)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene?
The InChIKey is MHKACPMSUQVVBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F8O/c10-7(11)18-6-2-4(8(12,13)14)1-5(3-6)9(15,16)17/h1-3,7H.
What are the key properties of 1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene?
1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene has a molecular weight of 280.11 g/mol, XLogP of 4.33, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene is sourced from PubChem (CID 2099931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).