C24H17ClFNO4 — CID 21000983
2-(6-chloro-7-methyl-4-oxo-2-phenylchromen-3-yl)oxy-N-(4-fluorophenyl)acetamide (PubChem CID 21000983) has the molecular formula C24H17ClFNO4 and a molecular weight of 437.85 g/mol. Its IUPAC name is 2-(6-chloro-7-methyl-4-oxo-2-phenylchromen-3-yl)oxy-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-(6-chloro-7-methyl-4-oxo-2-phenylchromen-3-yl)oxy-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 21000983 |
| Molecular Formula | C24H17ClFNO4 |
| Molecular Weight | 437.85 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 2-(6-chloro-7-methyl-4-oxo-2-phenylchromen-3-yl)oxy-N-(4-fluorophenyl)acetamide |
| SMILES | Cc1cc2oc(-c3ccccc3)c(OCC(=O)Nc3ccc(F)cc3)c(=O)c2cc1Cl |
| InChI | InChI=1S/C24H17ClFNO4/c1-14-11-20-18(12-19(14)25)22(29)24(23(31-20)15-5-3-2-4-6-15)30-13-21(28)27-17-9-7-16(26)8-10-17/h2-12H,13H2,1H3,(H,27,28) |
| InChIKey | SXAJGWNKWVYQCI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.85 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |