C28H21ClO4 — CID 21001350
6-chloro-2-(4-methoxyphenyl)-7-methyl-3-(naphthalen-1-ylmethoxy)chromen-4-one (PubChem CID 21001350) has the molecular formula C28H21ClO4 and a molecular weight of 456.93 g/mol. Its IUPAC name is 6-chloro-2-(4-methoxyphenyl)-7-methyl-3-(naphthalen-1-ylmethoxy)chromen-4-one.
| Compound Name | 6-chloro-2-(4-methoxyphenyl)-7-methyl-3-(naphthalen-1-ylmethoxy)chromen-4-one |
|---|---|
| PubChem CID | 21001350 |
| Molecular Formula | C28H21ClO4 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 6-chloro-2-(4-methoxyphenyl)-7-methyl-3-(naphthalen-1-ylmethoxy)chromen-4-one |
| SMILES | COc1ccc(-c2oc3cc(C)c(Cl)cc3c(=O)c2OCc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C28H21ClO4/c1-17-14-25-23(15-24(17)29)26(30)28(27(33-25)19-10-12-21(31-2)13-11-19)32-16-20-8-5-7-18-6-3-4-9-22(18)20/h3-15H,16H2,1-2H3 |
| InChIKey | CBSMVWULNLZVOJ-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |