C16H11N3O4 — CID 21002389
5-(quinazolin-4-ylamino)benzene-1,3-dicarboxylic acid (PubChem CID 21002389) has the molecular formula C16H11N3O4 and a molecular weight of 309.28 g/mol. Its IUPAC name is 5-(quinazolin-4-ylamino)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(quinazolin-4-ylamino)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 21002389 |
| Molecular Formula | C16H11N3O4 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 5-(quinazolin-4-ylamino)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(Nc2ncnc3ccccc23)cc(C(=O)O)c1 |
| InChI | InChI=1S/C16H11N3O4/c20-15(21)9-5-10(16(22)23)7-11(6-9)19-14-12-3-1-2-4-13(12)17-8-18-14/h1-8H,(H,20,21)(H,22,23)(H,17,18,19) |
| InChIKey | RZVKNYUATOCKTM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |