C14H11BrN4 — CID 21002502
6-bromo-N-(pyridin-2-ylmethyl)quinazolin-4-amine (PubChem CID 21002502) has the molecular formula C14H11BrN4 and a molecular weight of 315.17 g/mol. Its IUPAC name is 6-bromo-N-(pyridin-2-ylmethyl)quinazolin-4-amine.
| Compound Name | 6-bromo-N-(pyridin-2-ylmethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 21002502 |
| Molecular Formula | C14H11BrN4 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 6-bromo-N-(pyridin-2-ylmethyl)quinazolin-4-amine |
| SMILES | Brc1ccc2ncnc(NCc3ccccn3)c2c1 |
| InChI | InChI=1S/C14H11BrN4/c15-10-4-5-13-12(7-10)14(19-9-18-13)17-8-11-3-1-2-6-16-11/h1-7,9H,8H2,(H,17,18,19) |
| InChIKey | UWMNTCLVRWHHQG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |