C20H23N3O2 — CID 21002609
N-[2-(3,4-dimethoxyphenyl)ethyl]-6-ethylquinazolin-4-amine (PubChem CID 21002609) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-6-ethylquinazolin-4-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-6-ethylquinazolin-4-amine |
|---|---|
| PubChem CID | 21002609 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-6-ethylquinazolin-4-amine |
| SMILES | CCc1ccc2ncnc(NCCc3ccc(OC)c(OC)c3)c2c1 |
| InChI | InChI=1S/C20H23N3O2/c1-4-14-5-7-17-16(11-14)20(23-13-22-17)21-10-9-15-6-8-18(24-2)19(12-15)25-3/h5-8,11-13H,4,9-10H2,1-3H3,(H,21,22,23) |
| InChIKey | AUXSZHQQIKXLPH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |