About 6-methoxy-N,N-bis(2-methoxyethyl)quinazolin-4-amine
6-methoxy-N,N-bis(2-methoxyethyl)quinazolin-4-amine (PubChem CID 21002919) has the molecular formula C15H21N3O3
and a molecular weight of 291.35 g/mol. Its IUPAC name is 6-methoxy-N,N-bis(2-methoxyethyl)quinazolin-4-amine.
Molecular Properties
| Compound Name | 6-methoxy-N,N-bis(2-methoxyethyl)quinazolin-4-amine |
| PubChem CID | 21002919 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 6-methoxy-N,N-bis(2-methoxyethyl)quinazolin-4-amine |
| SMILES | COCCN(CCOC)c1ncnc2ccc(OC)cc12 |
| InChI | InChI=1S/C15H21N3O3/c1-19-8-6-18(7-9-20-2)15-13-10-12(21-3)4-5-14(13)16-11-17-15/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | NLFGYQYGHMQGHK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-methoxy-N,N-bis(2-methoxyethyl)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-N,N-bis(2-methoxyethyl)quinazolin-4-amine?
The IUPAC name of 6-methoxy-N,N-bis(2-methoxyethyl)quinazolin-4-amine (CID 21002919) is 6-methoxy-N,N-bis(2-methoxyethyl)quinazolin-4-amine.
What is the SMILES notation for 6-methoxy-N,N-bis(2-methoxyethyl)quinazolin-4-amine?
The canonical SMILES for 6-methoxy-N,N-bis(2-methoxyethyl)quinazolin-4-amine is COCCN(CCOC)c1ncnc2ccc(OC)cc12.
What is the InChIKey of 6-methoxy-N,N-bis(2-methoxyethyl)quinazolin-4-amine?
The InChIKey is NLFGYQYGHMQGHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O3/c1-19-8-6-18(7-9-20-2)15-13-10-12(21-3)4-5-14(13)16-11-17-15/h4-5,10-11H,6-9H2,1-3H3.
What are the key properties of 6-methoxy-N,N-bis(2-methoxyethyl)quinazolin-4-amine?
6-methoxy-N,N-bis(2-methoxyethyl)quinazolin-4-amine has a molecular weight of 291.35 g/mol, XLogP of 1.74, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-N,N-bis(2-methoxyethyl)quinazolin-4-amine is sourced from PubChem (CID 21002919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).