C12H11F3N2O2S — CID 21003265
3-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropane-1,2-diol (PubChem CID 21003265) has the molecular formula C12H11F3N2O2S and a molecular weight of 304.29 g/mol. Its IUPAC name is 3-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropane-1,2-diol.
| Compound Name | 3-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 21003265 |
| Molecular Formula | C12H11F3N2O2S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 3-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylpropane-1,2-diol |
| SMILES | OCC(O)CSc1nc(C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C12H11F3N2O2S/c13-12(14,15)11-16-9-4-2-1-3-8(9)10(17-11)20-6-7(19)5-18/h1-4,7,18-19H,5-6H2 |
| InChIKey | BXFGMJQFZWULBV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |