C22H30N4O5S2 — CID 21004768
N-[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-2-methyl-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide (PubChem CID 21004768) has the molecular formula C22H30N4O5S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-2-methyl-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-2-methyl-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 21004768 |
| Molecular Formula | C22H30N4O5S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | N-[2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-2-methyl-4-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide |
| SMILES | Cc1cc(N2C(=O)CCS2(=O)=O)ccc1S(=O)(=O)NCC(c1ccc(N(C)C)cc1)N(C)C |
| InChI | InChI=1S/C22H30N4O5S2/c1-16-14-19(26-22(27)12-13-32(26,28)29)10-11-21(16)33(30,31)23-15-20(25(4)5)17-6-8-18(9-7-17)24(2)3/h6-11,14,20,23H,12-13,15H2,1-5H3 |
| InChIKey | ZXVOQRIWDUVLJQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|